C38H46N2O4S — CID 158718840
2-[4-[1-benzothiophen-3-yl-[4-[ethyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]phenyl]methyl]-N-ethylanilino]ethyl 2,2-dimethylpropanoate (PubChem CID 158718840) has the molecular formula C38H46N2O4S and a molecular weight of 626.86 g/mol. Its IUPAC name is 2-[4-[1-benzothiophen-3-yl-[4-[ethyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]phenyl]methyl]-N-ethylanilino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[4-[1-benzothiophen-3-yl-[4-[ethyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]phenyl]methyl]-N-ethylanilino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 158718840 |
| Molecular Formula | C38H46N2O4S |
| Molecular Weight | 626.86 g/mol |
| Exact Mass | 626.32 |
| IUPAC Name | 2-[4-[1-benzothiophen-3-yl-[4-[ethyl-[2-(2-methylprop-2-enoyloxy)ethyl]amino]phenyl]methyl]-N-ethylanilino]ethyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCN(CC)c1ccc(C(c2ccc(N(CC)CCOC(=O)C(C)(C)C)cc2)c2csc3ccccc23)cc1 |
| InChI | InChI=1S/C38H46N2O4S/c1-8-39(22-24-43-36(41)27(3)4)30-18-14-28(15-19-30)35(33-26-45-34-13-11-10-12-32(33)34)29-16-20-31(21-17-29)40(9-2)23-25-44-37(42)38(5,6)7/h10-21,26,35H,3,8-9,22-25H2,1-2,4-7H3 |
| InChIKey | IJQRBFBITZFAIU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.86 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|