C26H36N2O3 — CID 139721076
[2,2-bis[2-(diethylamino)phenyl]-2-hydroxyethyl] 2-methylprop-2-enoate (PubChem CID 139721076) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is [2,2-bis[2-(diethylamino)phenyl]-2-hydroxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-bis[2-(diethylamino)phenyl]-2-hydroxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139721076 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [2,2-bis[2-(diethylamino)phenyl]-2-hydroxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)(c1ccccc1N(CC)CC)c1ccccc1N(CC)CC |
| InChI | InChI=1S/C26H36N2O3/c1-7-27(8-2)23-17-13-11-15-21(23)26(30,19-31-25(29)20(5)6)22-16-12-14-18-24(22)28(9-3)10-4/h11-18,30H,5,7-10,19H2,1-4,6H3 |
| InChIKey | UYNIIEWUZCLIMJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|