C19H25NO4 — CID 175503672
2-[propan-2-yl-(2-prop-1-en-2-ylphenyl)carbamoyl]oxyethyl 2-methylprop-2-enoate (PubChem CID 175503672) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[propan-2-yl-(2-prop-1-en-2-ylphenyl)carbamoyl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[propan-2-yl-(2-prop-1-en-2-ylphenyl)carbamoyl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175503672 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[propan-2-yl-(2-prop-1-en-2-ylphenyl)carbamoyl]oxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)N(c1ccccc1C(=C)C)C(C)C |
| InChI | InChI=1S/C19H25NO4/c1-13(2)16-9-7-8-10-17(16)20(15(5)6)19(22)24-12-11-23-18(21)14(3)4/h7-10,15H,1,3,11-12H2,2,4-6H3 |
| InChIKey | LXHOAFXKRIDUGW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|