C18H36ClN11OS — CID 162178314
(2R)-2-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 162178314) has the molecular formula C18H36ClN11OS and a molecular weight of 490.08 g/mol. Its IUPAC name is (2R)-2-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2R)-2-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 162178314 |
| Molecular Formula | C18H36ClN11OS |
| Molecular Weight | 490.08 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (2R)-2-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@@H](Nc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1)C(N)=O.Cl |
| InChI | InChI=1S/C18H35N11OS.ClH/c1-31-3-2-14(15(23)30)24-16-25-17(28-6-10(19)4-11(20)7-28)27-18(26-16)29-8-12(21)5-13(22)9-29;/h10-14H,2-9,19-22H2,1H3,(H2,23,30)(H,24,25,26,27);1H/t10-,11+,12-,13+,14-;/m1./s1 |
| InChIKey | KJKWNSGXHIWBER-KWEOQJDUSA-N |
| XLogP | -1.96 |
| TPSA | 204.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.08 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |