C20H46N6O2 — CID 162179209
1-ethyl-3-[3-[7-[3-(ethylcarbamoylamino)propylamino]heptylamino]propyl]urea;methane (PubChem CID 162179209) has the molecular formula C20H46N6O2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 1-ethyl-3-[3-[7-[3-(ethylcarbamoylamino)propylamino]heptylamino]propyl]urea;methane.
| Compound Name | 1-ethyl-3-[3-[7-[3-(ethylcarbamoylamino)propylamino]heptylamino]propyl]urea;methane |
|---|---|
| PubChem CID | 162179209 |
| Molecular Formula | C20H46N6O2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 1-ethyl-3-[3-[7-[3-(ethylcarbamoylamino)propylamino]heptylamino]propyl]urea;methane |
| SMILES | C.CCNC(=O)NCCCNCCCCCCCNCCCNC(=O)NCC |
| InChI | InChI=1S/C19H42N6O2.CH4/c1-3-22-18(26)24-16-10-14-20-12-8-6-5-7-9-13-21-15-11-17-25-19(27)23-4-2;/h20-21H,3-17H2,1-2H3,(H2,22,24,26)(H2,23,25,27);1H4 |
| InChIKey | ZOUHAQVAHAZOTM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|