C47H31F3N4O4S — CID 162181020
6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1-[6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)naphthalen-2-yl]naphthalen-2-ol;trifluoromethanesulfonic acid (PubChem CID 162181020) has the molecular formula C47H31F3N4O4S and a molecular weight of 804.85 g/mol. Its IUPAC name is 6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1-[6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)naphthalen-2-yl]naphthalen-2-ol;trifluoromethanesulfonic acid.
| Compound Name | 6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1-[6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)naphthalen-2-yl]naphthalen-2-ol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162181020 |
| Molecular Formula | C47H31F3N4O4S |
| Molecular Weight | 804.85 g/mol |
| Exact Mass | 804.20 |
| IUPAC Name | 6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1-[6-(4-imidazo[1,2-a]pyridin-2-ylphenyl)naphthalen-2-yl]naphthalen-2-ol;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.Oc1ccc2cc(-c3ccc(-c4cn5ccccc5n4)cc3)ccc2c1-c1ccc2cc(-c3ccc(-c4cn5ccccc5n4)cc3)ccc2c1 |
| InChI | InChI=1S/C46H30N4O.CHF3O3S/c51-43-22-20-38-26-35(31-9-13-33(14-10-31)42-29-50-24-4-2-6-45(50)48-42)19-21-40(38)46(43)39-18-17-36-25-34(15-16-37(36)27-39)30-7-11-32(12-8-30)41-28-49-23-3-1-5-44(49)47-41;2-1(3,4)8(5,6)7/h1-29,51H;(H,5,6,7) |
| InChIKey | ZPACQGSINMQQAX-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.85 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|