C22H28N4O5 — CID 162181886
1,3-diphenylurea;1H-imidazole;propanoic acid (PubChem CID 162181886) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1,3-diphenylurea;1H-imidazole;propanoic acid.
| Compound Name | 1,3-diphenylurea;1H-imidazole;propanoic acid |
|---|---|
| PubChem CID | 162181886 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1,3-diphenylurea;1H-imidazole;propanoic acid |
| SMILES | CCC(=O)O.CCC(=O)O.O=C(Nc1ccccc1)Nc1ccccc1.c1c[nH]cn1 |
| InChI | InChI=1S/C13H12N2O.C3H4N2.2C3H6O2/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-2-5-3-4-1;2*1-2-3(4)5/h1-10H,(H2,14,15,16);1-3H,(H,4,5);2*2H2,1H3,(H,4,5) |
| InChIKey | ZPDFIZUPOYPFBX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |