C35H49N2O6+ — CID 162183885
ethyl 2-[1-(3,3-diethoxypropyl)-2,3-dimethylindol-1-ium-3-yl]acetate;ethyl 2-(2,3-dimethylindol-3-yl)acetate (PubChem CID 162183885) has the molecular formula C35H49N2O6+ and a molecular weight of 593.79 g/mol. Its IUPAC name is ethyl 2-[1-(3,3-diethoxypropyl)-2,3-dimethylindol-1-ium-3-yl]acetate;ethyl 2-(2,3-dimethylindol-3-yl)acetate.
| Compound Name | ethyl 2-[1-(3,3-diethoxypropyl)-2,3-dimethylindol-1-ium-3-yl]acetate;ethyl 2-(2,3-dimethylindol-3-yl)acetate |
|---|---|
| PubChem CID | 162183885 |
| Molecular Formula | C35H49N2O6+ |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | ethyl 2-[1-(3,3-diethoxypropyl)-2,3-dimethylindol-1-ium-3-yl]acetate;ethyl 2-(2,3-dimethylindol-3-yl)acetate |
| SMILES | CCOC(=O)CC1(C)C(C)=Nc2ccccc21.CCOC(=O)CC1(C)C(C)=[N+](CCC(OCC)OCC)c2ccccc21 |
| InChI | InChI=1S/C21H32NO4.C14H17NO2/c1-6-24-19(23)15-21(5)16(4)22(18-12-10-9-11-17(18)21)14-13-20(25-7-2)26-8-3;1-4-17-13(16)9-14(3)10(2)15-12-8-6-5-7-11(12)14/h9-12,20H,6-8,13-15H2,1-5H3;5-8H,4,9H2,1-3H3/q+1; |
| InChIKey | ZPKDTZPAHVSFCY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|