C30H29F3N6O9S — CID 162189662
1-(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;methyl 4-(2-methoxyethylamino)-3-nitrobenzoate (PubChem CID 162189662) has the molecular formula C30H29F3N6O9S and a molecular weight of 706.66 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;methyl 4-(2-methoxyethylamino)-3-nitrobenzoate.
| Compound Name | 1-(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 162189662 |
| Molecular Formula | C30H29F3N6O9S |
| Molecular Weight | 706.66 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxylic acid;methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
| SMILES | COCCNc1ccc(C(=O)OC)cc1[N+](=O)[O-].COCCn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C19H15F3N4O4S.C11H14N2O5/c1-29-7-6-26-14-5-2-10(16(27)28)8-13(14)23-17(26)25-18-24-12-4-3-11(9-15(12)31-18)30-19(20,21)22;1-17-6-5-12-9-4-3-8(11(14)18-2)7-10(9)13(15)16/h2-5,8-9H,6-7H2,1H3,(H,27,28)(H,23,24,25);3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | ZQCZXPZPOZKQHZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 189.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|