C48H86O8 — CID 162195282
2-(4-butylcyclohexyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane;2-(4-butylcyclohexyl)-5-[2-(5-prop-1-enyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane (PubChem CID 162195282) has the molecular formula C48H86O8 and a molecular weight of 791.21 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane;2-(4-butylcyclohexyl)-5-[2-(5-prop-1-enyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane.
| Compound Name | 2-(4-butylcyclohexyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane;2-(4-butylcyclohexyl)-5-[2-(5-prop-1-enyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 162195282 |
| Molecular Formula | C48H86O8 |
| Molecular Weight | 791.21 g/mol |
| Exact Mass | 790.63 |
| IUPAC Name | 2-(4-butylcyclohexyl)-5-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane;2-(4-butylcyclohexyl)-5-[2-(5-prop-1-enyl-1,3-dioxan-2-yl)ethyl]-1,3-dioxane |
| SMILES | CC=CC1COC(CCC2COC(C3CCC(CCCC)CC3)OC2)OC1.CCCCCC1COC(CCC2COC(C3CCC(CCCC)CC3)OC2)OC1 |
| InChI | InChI=1S/C25H46O4.C23H40O4/c1-3-5-7-9-21-16-26-24(27-17-21)15-12-22-18-28-25(29-19-22)23-13-10-20(11-14-23)8-6-4-2;1-3-5-7-18-8-11-21(12-9-18)23-26-16-20(17-27-23)10-13-22-24-14-19(6-4-2)15-25-22/h20-25H,3-19H2,1-2H3;4,6,18-23H,3,5,7-17H2,1-2H3 |
| InChIKey | ZQVWVRAARURDQL-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.21 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|