About methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol
methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol (PubChem CID 162201980) has the molecular formula C13H30O7
and a molecular weight of 298.38 g/mol. Its IUPAC name is methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol.
Molecular Properties
| Compound Name | methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol |
| PubChem CID | 162201980 |
| Molecular Formula | C13H30O7 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol |
| SMILES | C.C.C.OC(COCOCC1CO1)COCOC1CO1 |
| InChI | InChI=1S/C10H18O7.3CH4/c11-8(2-13-7-17-10-5-16-10)1-12-6-14-3-9-4-15-9;;;/h8-11H,1-7H2;3*1H4 |
| InChIKey | ZRSAGNXGRGIROU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol?
The IUPAC name of methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol (CID 162201980) is methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol.
What is the SMILES notation for methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol?
The canonical SMILES for methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol is C.C.C.OC(COCOCC1CO1)COCOC1CO1.
What is the InChIKey of methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol?
The InChIKey is ZRSAGNXGRGIROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O7.3CH4/c11-8(2-13-7-17-10-5-16-10)1-12-6-14-3-9-4-15-9;;;/h8-11H,1-7H2;3*1H4.
What are the key properties of methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol?
methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol has a molecular weight of 298.38 g/mol, XLogP of 0.99, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(oxiran-2-ylmethoxymethoxy)-3-(oxiran-2-yloxymethoxy)propan-2-ol is sourced from PubChem (CID 162201980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).