About bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane
bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane (PubChem CID 162209740) has the molecular formula C22H27ClSi
and a molecular weight of 355.00 g/mol. Its IUPAC name is bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane.
Molecular Properties
| Compound Name | bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane |
| PubChem CID | 162209740 |
| Molecular Formula | C22H27ClSi |
| Molecular Weight | 355.00 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane |
| SMILES | C=Cc1ccc(C=C)cc1.C=Cc1ccc(C=C)cc1.CC[SiH2]Cl |
| InChI | InChI=1S/2C10H10.C2H7ClSi/c2*1-3-9-5-7-10(4-2)8-6-9;1-2-4-3/h2*3-8H,1-2H2;2,4H2,1H3 |
| InChIKey | ZSRKVZBJCALGNM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.00 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane?
The IUPAC name of bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane (CID 162209740) is bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane.
What is the SMILES notation for bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane?
The canonical SMILES for bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane is C=Cc1ccc(C=C)cc1.C=Cc1ccc(C=C)cc1.CC[SiH2]Cl.
What is the InChIKey of bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane?
The InChIKey is ZSRKVZBJCALGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H10.C2H7ClSi/c2*1-3-9-5-7-10(4-2)8-6-9;1-2-4-3/h2*3-8H,1-2H2;2,4H2,1H3.
What are the key properties of bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane?
bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane has a molecular weight of 355.00 g/mol, XLogP of 6.69, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane is sourced from PubChem (CID 162209740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).