C22H27ClSi — CID 162209740
bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane (PubChem CID 162209740) has the molecular formula C22H27ClSi and a molecular weight of 355.00 g/mol. Its IUPAC name is bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane.
| Compound Name | bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane |
|---|---|
| PubChem CID | 162209740 |
| Molecular Formula | C22H27ClSi |
| Molecular Weight | 355.00 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | bis(1,4-bis(ethenyl)benzene);chloro(ethyl)silane |
| SMILES | C=Cc1ccc(C=C)cc1.C=Cc1ccc(C=C)cc1.CC[SiH2]Cl |
| InChI | InChI=1S/2C10H10.C2H7ClSi/c2*1-3-9-5-7-10(4-2)8-6-9;1-2-4-3/h2*3-8H,1-2H2;2,4H2,1H3 |
| InChIKey | ZSRKVZBJCALGNM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.00 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|