About 1-chloro-4-ethenylbenzene;ethanol
1-chloro-4-ethenylbenzene;ethanol (PubChem CID 175389019) has the molecular formula C10H13ClO
and a molecular weight of 184.67 g/mol. Its IUPAC name is 1-chloro-4-ethenylbenzene;ethanol.
Molecular Properties
| Compound Name | 1-chloro-4-ethenylbenzene;ethanol |
| PubChem CID | 175389019 |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-chloro-4-ethenylbenzene;ethanol |
| SMILES | C=Cc1ccc(Cl)cc1.CCO |
| InChI | InChI=1S/C8H7Cl.C2H6O/c1-2-7-3-5-8(9)6-4-7;1-2-3/h2-6H,1H2;3H,2H2,1H3 |
| InChIKey | XRNQWYIZRKWKAV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-ethenylbenzene;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-ethenylbenzene;ethanol?
The IUPAC name of 1-chloro-4-ethenylbenzene;ethanol (CID 175389019) is 1-chloro-4-ethenylbenzene;ethanol.
What is the SMILES notation for 1-chloro-4-ethenylbenzene;ethanol?
The canonical SMILES for 1-chloro-4-ethenylbenzene;ethanol is C=Cc1ccc(Cl)cc1.CCO.
What is the InChIKey of 1-chloro-4-ethenylbenzene;ethanol?
The InChIKey is XRNQWYIZRKWKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl.C2H6O/c1-2-7-3-5-8(9)6-4-7;1-2-3/h2-6H,1H2;3H,2H2,1H3.
What are the key properties of 1-chloro-4-ethenylbenzene;ethanol?
1-chloro-4-ethenylbenzene;ethanol has a molecular weight of 184.67 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-ethenylbenzene;ethanol is sourced from PubChem (CID 175389019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).