About ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride
ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride (PubChem CID 175426903) has the molecular formula C22H40ClOP
and a molecular weight of 386.99 g/mol. Its IUPAC name is ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride.
Molecular Properties
| Compound Name | ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride |
| PubChem CID | 175426903 |
| Molecular Formula | C22H40ClOP |
| Molecular Weight | 386.99 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride |
| SMILES | C=Cc1ccc([P+](CCCC)(CCCC)CCCC)cc1.CCO.[Cl-] |
| InChI | InChI=1S/C20H34P.C2H6O.ClH/c1-5-9-16-21(17-10-6-2,18-11-7-3)20-14-12-19(8-4)13-15-20;1-2-3;/h8,12-15H,4-7,9-11,16-18H2,1-3H3;3H,2H2,1H3;1H/q+1;;/p-1 |
| InChIKey | AISLDHMXSDWADF-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride?
The IUPAC name of ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride (CID 175426903) is ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride.
What is the SMILES notation for ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride?
The canonical SMILES for ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride is C=Cc1ccc([P+](CCCC)(CCCC)CCCC)cc1.CCO.[Cl-].
What is the InChIKey of ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride?
The InChIKey is AISLDHMXSDWADF-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H34P.C2H6O.ClH/c1-5-9-16-21(17-10-6-2,18-11-7-3)20-14-12-19(8-4)13-15-20;1-2-3;/h8,12-15H,4-7,9-11,16-18H2,1-3H3;3H,2H2,1H3;1H/q+1;;/p-1.
What are the key properties of ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride?
ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride has a molecular weight of 386.99 g/mol, XLogP of 3.38, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;tributyl-(4-ethenylphenyl)phosphanium;chloride is sourced from PubChem (CID 175426903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).