C18H22N2O8Zn — CID 162212928
bis(4-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc (PubChem CID 162212928) has the molecular formula C18H22N2O8Zn and a molecular weight of 459.77 g/mol. Its IUPAC name is bis(4-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc.
| Compound Name | bis(4-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc |
|---|---|
| PubChem CID | 162212928 |
| Molecular Formula | C18H22N2O8Zn |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | bis(4-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc |
| SMILES | CC1=CC(=O)N(CCCC(=O)O)C1=O.CC1=CC(=O)N(CCCC(=O)O)C1=O.[Zn] |
| InChI | InChI=1S/2C9H11NO4.Zn/c2*1-6-5-7(11)10(9(6)14)4-2-3-8(12)13;/h2*5H,2-4H2,1H3,(H,12,13); |
| InChIKey | ZTCAJEMMMNDWHW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|