carbon dioxide;tricosanoic acid

C24H46O4 — CID 162218172

IUPACcarbon dioxide;tricosanoic acid
SMILESCCCCCCCCCCCCCCCCCCCCCCC(=O)O.O=C=O
InChIInChI=1S/C23H46O2.CO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25;2-1-3/h2-22H2,1H3,(H,24,25);
InChIKeyZTTIFFIGMZDMBT-UHFFFAOYSA-N
MW398.63 g/mol
LogP7.70
Rot. Bonds21

About carbon dioxide;tricosanoic acid

carbon dioxide;tricosanoic acid (PubChem CID 162218172) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is carbon dioxide;tricosanoic acid.

Molecular Properties

Compound Namecarbon dioxide;tricosanoic acid
PubChem CID162218172
Molecular FormulaC24H46O4
Molecular Weight398.63 g/mol
Exact Mass398.34
IUPAC Namecarbon dioxide;tricosanoic acid
SMILESCCCCCCCCCCCCCCCCCCCCCCC(=O)O.O=C=O
InChIInChI=1S/C23H46O2.CO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25;2-1-3/h2-22H2,1H3,(H,24,25);
InChIKeyZTTIFFIGMZDMBT-UHFFFAOYSA-N
XLogP7.70
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds21
Heavy Atoms28
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500398.63
LogP ≤ 57.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze carbon dioxide;tricosanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;tricosanoic acid?
The IUPAC name of carbon dioxide;tricosanoic acid (CID 162218172) is carbon dioxide;tricosanoic acid.
What is the SMILES notation for carbon dioxide;tricosanoic acid?
The canonical SMILES for carbon dioxide;tricosanoic acid is CCCCCCCCCCCCCCCCCCCCCCC(=O)O.O=C=O.
What is the InChIKey of carbon dioxide;tricosanoic acid?
The InChIKey is ZTTIFFIGMZDMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O2.CO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25;2-1-3/h2-22H2,1H3,(H,24,25);.
What are the key properties of carbon dioxide;tricosanoic acid?
carbon dioxide;tricosanoic acid has a molecular weight of 398.63 g/mol, XLogP of 7.70, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;tricosanoic acid is sourced from PubChem (CID 162218172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).