C26H19Cl2F3N4O3 — CID 162224392
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(5-ethynylpyrimidin-2-yl)-N-(methoxymethyl)-2-methylbenzamide (PubChem CID 162224392) has the molecular formula C26H19Cl2F3N4O3 and a molecular weight of 563.36 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(5-ethynylpyrimidin-2-yl)-N-(methoxymethyl)-2-methylbenzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(5-ethynylpyrimidin-2-yl)-N-(methoxymethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 162224392 |
| Molecular Formula | C26H19Cl2F3N4O3 |
| Molecular Weight | 563.36 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(5-ethynylpyrimidin-2-yl)-N-(methoxymethyl)-2-methylbenzamide |
| SMILES | C#Cc1cnc(N(COC)C(=O)c2ccc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)cc2C)nc1 |
| InChI | InChI=1S/C26H19Cl2F3N4O3/c1-4-16-12-32-24(33-13-16)35(14-37-3)23(36)21-6-5-17(7-15(21)2)22-11-25(38-34-22,26(29,30)31)18-8-19(27)10-20(28)9-18/h1,5-10,12-13H,11,14H2,2-3H3 |
| InChIKey | CDRGGRZQNQACCM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|