C33H32N4O8 — CID 162224937
2-cyanoethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;methane (PubChem CID 162224937) has the molecular formula C33H32N4O8 and a molecular weight of 612.64 g/mol. Its IUPAC name is 2-cyanoethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;methane.
| Compound Name | 2-cyanoethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;methane |
|---|---|
| PubChem CID | 162224937 |
| Molecular Formula | C33H32N4O8 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 2-cyanoethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate;methane |
| SMILES | C.COc1cc(C#N)ccc1/C=C(/C(C)=O)C(=O)OCCC#N.COc1cc(C#N)ccc1/C=C(\C(C)=O)C(=O)OCCC#N |
| InChI | InChI=1S/2C16H14N2O4.CH4/c2*1-11(19)14(16(20)22-7-3-6-17)9-13-5-4-12(10-18)8-15(13)21-2;/h2*4-5,8-9H,3,7H2,1-2H3;1H4/b14-9+;14-9-; |
| InChIKey | ZUPYJTPHVFELJB-YDDROQMISA-N |
| XLogP | 4.63 |
| TPSA | 200.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|