About 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate
2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate (PubChem CID 142085056) has the molecular formula C14H11ClFNO3
and a molecular weight of 295.70 g/mol. Its IUPAC name is 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate.
Molecular Properties
| Compound Name | 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate |
| PubChem CID | 142085056 |
| Molecular Formula | C14H11ClFNO3 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate |
| SMILES | CC(=O)/C(=C/c1ccc(F)cc1Cl)C(=O)OCCC#N |
| InChI | InChI=1S/C14H11ClFNO3/c1-9(18)12(14(19)20-6-2-5-17)7-10-3-4-11(16)8-13(10)15/h3-4,7-8H,2,6H2,1H3/b12-7- |
| InChIKey | BMFAZVUAHNXJAO-GHXNOFRVSA-N |
| XLogP | 2.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate?
The IUPAC name of 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate (CID 142085056) is 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate.
What is the SMILES notation for 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate?
The canonical SMILES for 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate is CC(=O)/C(=C/c1ccc(F)cc1Cl)C(=O)OCCC#N.
What is the InChIKey of 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate?
The InChIKey is BMFAZVUAHNXJAO-GHXNOFRVSA-N. The full InChI is InChI=1S/C14H11ClFNO3/c1-9(18)12(14(19)20-6-2-5-17)7-10-3-4-11(16)8-13(10)15/h3-4,7-8H,2,6H2,1H3/b12-7-.
What are the key properties of 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate?
2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate has a molecular weight of 295.70 g/mol, XLogP of 2.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl (2Z)-2-[(2-chloro-4-fluorophenyl)methylidene]-3-oxobutanoate is sourced from PubChem (CID 142085056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).