C19H23NO6 — CID 59186913
ethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-4,4-diethoxy-3-oxobutanoate (PubChem CID 59186913) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-4,4-diethoxy-3-oxobutanoate.
| Compound Name | ethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-4,4-diethoxy-3-oxobutanoate |
|---|---|
| PubChem CID | 59186913 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl (2Z)-2-[(4-cyano-2-methoxyphenyl)methylidene]-4,4-diethoxy-3-oxobutanoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(C#N)cc1OC)C(=O)C(OCC)OCC |
| InChI | InChI=1S/C19H23NO6/c1-5-24-18(22)15(17(21)19(25-6-2)26-7-3)11-14-9-8-13(12-20)10-16(14)23-4/h8-11,19H,5-7H2,1-4H3/b15-11- |
| InChIKey | VIFCWDFHAHFUMR-PTNGSMBKSA-N |
| XLogP | 2.48 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|