C21H24N4O2 — CID 162230999
ethyl 4-[6-(4-methyl-2-pyridinyl)-7H-cyclopenta[b]pyridin-4-yl]piperazine-1-carboxylate (PubChem CID 162230999) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethyl 4-[6-(4-methyl-2-pyridinyl)-7H-cyclopenta[b]pyridin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(4-methyl-2-pyridinyl)-7H-cyclopenta[b]pyridin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162230999 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | ethyl 4-[6-(4-methyl-2-pyridinyl)-7H-cyclopenta[b]pyridin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccnc3c2C=C(c2cc(C)ccn2)C3)CC1 |
| InChI | InChI=1S/C21H24N4O2/c1-3-27-21(26)25-10-8-24(9-11-25)20-5-7-23-19-14-16(13-17(19)20)18-12-15(2)4-6-22-18/h4-7,12-13H,3,8-11,14H2,1-2H3 |
| InChIKey | ZVKRZSHFINPCNV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |