C13H20N2O3 — CID 162231013
1,3-bis(4-oxohex-5-enyl)urea (PubChem CID 162231013) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,3-bis(4-oxohex-5-enyl)urea.
| Compound Name | 1,3-bis(4-oxohex-5-enyl)urea |
|---|---|
| PubChem CID | 162231013 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1,3-bis(4-oxohex-5-enyl)urea |
| SMILES | C=CC(=O)CCCNC(=O)NCCCC(=O)C=C |
| InChI | InChI=1S/C13H20N2O3/c1-3-11(16)7-5-9-14-13(18)15-10-6-8-12(17)4-2/h3-4H,1-2,5-10H2,(H2,14,15,18) |
| InChIKey | XLBKGXZSFOMJQZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|