C29H37BrN2O4Si — CID 162234875
2-(3-bromophenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-(2-trimethylsilylethynyl)phenyl]ethanone (PubChem CID 162234875) has the molecular formula C29H37BrN2O4Si and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-(2-trimethylsilylethynyl)phenyl]ethanone.
| Compound Name | 2-(3-bromophenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-(2-trimethylsilylethynyl)phenyl]ethanone |
|---|---|
| PubChem CID | 162234875 |
| Molecular Formula | C29H37BrN2O4Si |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 2-(3-bromophenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-(2-trimethylsilylethynyl)phenyl]ethanone |
| SMILES | C[Si](C)(C)C#Cc1cccc(CC(=O)N2CCOCC2)c1.O=C(Cc1cccc(Br)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H23NO2Si.C12H14BrNO2/c1-21(2,3)12-7-15-5-4-6-16(13-15)14-17(19)18-8-10-20-11-9-18;13-11-3-1-2-10(8-11)9-12(15)14-4-6-16-7-5-14/h4-6,13H,8-11,14H2,1-3H3;1-3,8H,4-7,9H2 |
| InChIKey | ZVXSGMRQTFASJQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|