C34H43BN2O6 — CID 161375681
2-(3-ethynylphenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone (PubChem CID 161375681) has the molecular formula C34H43BN2O6 and a molecular weight of 586.54 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone.
| Compound Name | 2-(3-ethynylphenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 161375681 |
| Molecular Formula | C34H43BN2O6 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 2-(3-ethynylphenyl)-1-morpholin-4-ylethanone;1-morpholin-4-yl-2-[3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone |
| SMILES | C#Cc1cccc(CC(=O)N2CCOCC2)c1.CC1(C)OB(/C=C/c2cccc(CC(=O)N3CCOCC3)c2)OC1(C)C |
| InChI | InChI=1S/C20H28BNO4.C14H15NO2/c1-19(2)20(3,4)26-21(25-19)9-8-16-6-5-7-17(14-16)15-18(23)22-10-12-24-13-11-22;1-2-12-4-3-5-13(10-12)11-14(16)15-6-8-17-9-7-15/h5-9,14H,10-13,15H2,1-4H3;1,3-5,10H,6-9,11H2/b9-8+; |
| InChIKey | VRAXASLXAQSNMZ-HRNDJLQDSA-N |
| XLogP | 3.80 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|