C16H26 — CID 162248027
2-tert-butyl-1,3-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene (PubChem CID 162248027) has the molecular formula C16H26 and a molecular weight of 232.47 g/mol. Its IUPAC name is 2-tert-butyl-1,3-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene.
| Compound Name | 2-tert-butyl-1,3-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
|---|---|
| PubChem CID | 162248027 |
| Molecular Formula | C16H26 |
| Molecular Weight | 232.47 g/mol |
| Exact Mass | 232.29 |
| IUPAC Name | 2-tert-butyl-1,3-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cccc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1C(C)(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H26/c1-11(2)13-9-8-10-14(12(3)4)15(13)16(5,6)7/h8-12H,1-7H3/i1D3,2D3,3D3,4D3,11D,12D |
| InChIKey | FOMFJOOBYVJEDB-JNZCBWKFSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |