C13H18N4O2 — CID 162271441
1-ethenyl-3-[2-(ethylcarbamoylamino)-4-methylphenyl]urea (PubChem CID 162271441) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-ethenyl-3-[2-(ethylcarbamoylamino)-4-methylphenyl]urea.
| Compound Name | 1-ethenyl-3-[2-(ethylcarbamoylamino)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 162271441 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-ethenyl-3-[2-(ethylcarbamoylamino)-4-methylphenyl]urea |
| SMILES | C=CNC(=O)Nc1ccc(C)cc1NC(=O)NCC |
| InChI | InChI=1S/C13H18N4O2/c1-4-14-12(18)16-10-7-6-9(3)8-11(10)17-13(19)15-5-2/h4,6-8H,1,5H2,2-3H3,(H2,14,16,18)(H2,15,17,19) |
| InChIKey | XIINOHGBQFXRNC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |