C12H14N2O4 — CID 54471177
[(2-hydroxy-5-methylphenyl)carbamoylamino]methyl prop-2-enoate (PubChem CID 54471177) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is [(2-hydroxy-5-methylphenyl)carbamoylamino]methyl prop-2-enoate.
| Compound Name | [(2-hydroxy-5-methylphenyl)carbamoylamino]methyl prop-2-enoate |
|---|---|
| PubChem CID | 54471177 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [(2-hydroxy-5-methylphenyl)carbamoylamino]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCNC(=O)Nc1cc(C)ccc1O |
| InChI | InChI=1S/C12H14N2O4/c1-3-11(16)18-7-13-12(17)14-9-6-8(2)4-5-10(9)15/h3-6,15H,1,7H2,2H3,(H2,13,14,17) |
| InChIKey | XILWPZXHYJWHKM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|