C27H22N2 — CID 162279073
1-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-3-phenyl-2H-imidazole (PubChem CID 162279073) has the molecular formula C27H22N2 and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-3-phenyl-2H-imidazole.
| Compound Name | 1-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-3-phenyl-2H-imidazole |
|---|---|
| PubChem CID | 162279073 |
| Molecular Formula | C27H22N2 |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-3-phenyl-2H-imidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2N2C=CN(c3ccccc3)C2)c([2H])c1[2H] |
| InChI | InChI=1S/C27H22N2/c1-4-11-22(12-5-1)25-17-10-18-26(23-13-6-2-7-14-23)27(25)29-20-19-28(21-29)24-15-8-3-9-16-24/h1-20H,21H2/i1D,2D,4D,5D,6D,7D,11D,12D,13D,14D |
| InChIKey | FHLPXTCOWVGMIB-WDAWXDKYSA-N |
| XLogP | 6.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |