C24H31NOS — CID 162284071
ethane;1,10,18,18,19,19-hexamethyl-8-oxa-4-thia-11-azapentacyclo[9.8.0.02,9.03,7.012,17]nonadeca-2(9),3(7),5,12,14,16-hexaene (PubChem CID 162284071) has the molecular formula C24H31NOS and a molecular weight of 381.59 g/mol. Its IUPAC name is ethane;1,10,18,18,19,19-hexamethyl-8-oxa-4-thia-11-azapentacyclo[9.8.0.02,9.03,7.012,17]nonadeca-2(9),3(7),5,12,14,16-hexaene.
| Compound Name | ethane;1,10,18,18,19,19-hexamethyl-8-oxa-4-thia-11-azapentacyclo[9.8.0.02,9.03,7.012,17]nonadeca-2(9),3(7),5,12,14,16-hexaene |
|---|---|
| PubChem CID | 162284071 |
| Molecular Formula | C24H31NOS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | ethane;1,10,18,18,19,19-hexamethyl-8-oxa-4-thia-11-azapentacyclo[9.8.0.02,9.03,7.012,17]nonadeca-2(9),3(7),5,12,14,16-hexaene |
| SMILES | CC.CC1c2oc3ccsc3c2C2(C)N1c1ccccc1C(C)(C)C2(C)C |
| InChI | InChI=1S/C22H25NOS.C2H6/c1-13-18-17(19-16(24-18)11-12-25-19)22(6)21(4,5)20(2,3)14-9-7-8-10-15(14)23(13)22;1-2/h7-13H,1-6H3;1-2H3 |
| InChIKey | PUBXEMPPASHRDJ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |