C30H40IrNO2- — CID 162285815
1-(3,5-dimethylbenzene-6-id-1-yl)-5,7-bis(2-methylpropyl)isoquinoline;iridium;pent-2-ene-2,4-diol (PubChem CID 162285815) has the molecular formula C30H40IrNO2- and a molecular weight of 638.87 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-5,7-bis(2-methylpropyl)isoquinoline;iridium;pent-2-ene-2,4-diol.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-5,7-bis(2-methylpropyl)isoquinoline;iridium;pent-2-ene-2,4-diol |
|---|---|
| PubChem CID | 162285815 |
| Molecular Formula | C30H40IrNO2- |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-5,7-bis(2-methylpropyl)isoquinoline;iridium;pent-2-ene-2,4-diol |
| SMILES | CC(O)=CC(C)O.Cc1[c-]c(-c2nccc3c(CC(C)C)cc(CC(C)C)cc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C25H30N.C5H10O2.Ir/c1-16(2)9-20-14-21(10-17(3)4)23-7-8-26-25(24(23)15-20)22-12-18(5)11-19(6)13-22;1-4(6)3-5(2)7;/h7-8,11-12,14-17H,9-10H2,1-6H3;3-4,6-7H,1-2H3;/q-1;; |
| InChIKey | MMXPNRFQVMOTCF-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|