C21H26N2 — CID 162296643
10-methyl-11-(2,3,5-trimethylphenyl)-9,11-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene (PubChem CID 162296643) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 10-methyl-11-(2,3,5-trimethylphenyl)-9,11-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene.
| Compound Name | 10-methyl-11-(2,3,5-trimethylphenyl)-9,11-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 162296643 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 10-methyl-11-(2,3,5-trimethylphenyl)-9,11-diazatricyclo[7.2.2.02,7]trideca-2,4,6-triene |
| SMILES | Cc1cc(C)c(C)c(N2C3CCN(Cc4ccccc43)C2C)c1 |
| InChI | InChI=1S/C21H26N2/c1-14-11-15(2)16(3)21(12-14)23-17(4)22-10-9-20(23)19-8-6-5-7-18(19)13-22/h5-8,11-12,17,20H,9-10,13H2,1-4H3 |
| InChIKey | SXGFNSJBMUMERF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |