C12H15NO2 — CID 101469707
(1R,2S,10bR)-1,2,3,4,6,10b-hexahydropyrido[2,1-a]isoindole-1,2-diol (PubChem CID 101469707) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R,2S,10bR)-1,2,3,4,6,10b-hexahydropyrido[2,1-a]isoindole-1,2-diol.
| Compound Name | (1R,2S,10bR)-1,2,3,4,6,10b-hexahydropyrido[2,1-a]isoindole-1,2-diol |
|---|---|
| PubChem CID | 101469707 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1R,2S,10bR)-1,2,3,4,6,10b-hexahydropyrido[2,1-a]isoindole-1,2-diol |
| SMILES | O[C@@H]1[C@H]2c3ccccc3CN2CC[C@@H]1O |
| InChI | InChI=1S/C12H15NO2/c14-10-5-6-13-7-8-3-1-2-4-9(8)11(13)12(10)15/h1-4,10-12,14-15H,5-7H2/t10-,11+,12-/m0/s1 |
| InChIKey | GIKCGBLRERBBGJ-TUAOUCFPSA-N |
| XLogP | 0.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |