C9H9NO4S — CID 162304255
acetic acid;3-hydroxy-1,3-benzothiazol-2-one (PubChem CID 162304255) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is acetic acid;3-hydroxy-1,3-benzothiazol-2-one.
| Compound Name | acetic acid;3-hydroxy-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 162304255 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | acetic acid;3-hydroxy-1,3-benzothiazol-2-one |
| SMILES | CC(=O)O.O=c1sc2ccccc2n1O |
| InChI | InChI=1S/C7H5NO2S.C2H4O2/c9-7-8(10)5-3-1-2-4-6(5)11-7;1-2(3)4/h1-4,10H;1H3,(H,3,4) |
| InChIKey | PBLUESPYYMOENL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|