C22H22Cl2N2O4Zn — CID 162305532
5-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]-2-pyridin-2-ylpyridine;dichlorozinc (PubChem CID 162305532) has the molecular formula C22H22Cl2N2O4Zn and a molecular weight of 514.72 g/mol. Its IUPAC name is 5-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]-2-pyridin-2-ylpyridine;dichlorozinc.
| Compound Name | 5-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]-2-pyridin-2-ylpyridine;dichlorozinc |
|---|---|
| PubChem CID | 162305532 |
| Molecular Formula | C22H22Cl2N2O4Zn |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 5-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]-2-pyridin-2-ylpyridine;dichlorozinc |
| SMILES | COCOc1ccc(C=Cc2ccc(-c3ccccn3)nc2)cc1OCOC.Cl[Zn]Cl |
| InChI | InChI=1S/C22H22N2O4.2ClH.Zn/c1-25-15-27-21-11-9-17(13-22(21)28-16-26-2)6-7-18-8-10-20(24-14-18)19-5-3-4-12-23-19;;;/h3-14H,15-16H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AXANNYPDLHJZFS-UHFFFAOYSA-L |
| XLogP | 5.66 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|