C9H7NO4S — CID 162308201
1,2-benzothiazole;oxalic acid (PubChem CID 162308201) has the molecular formula C9H7NO4S and a molecular weight of 225.23 g/mol. Its IUPAC name is 1,2-benzothiazole;oxalic acid.
| Compound Name | 1,2-benzothiazole;oxalic acid |
|---|---|
| PubChem CID | 162308201 |
| Molecular Formula | C9H7NO4S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1,2-benzothiazole;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc2sncc2c1 |
| InChI | InChI=1S/C7H5NS.C2H2O4/c1-2-4-7-6(3-1)5-8-9-7;3-1(4)2(5)6/h1-5H;(H,3,4)(H,5,6) |
| InChIKey | FLMCKSAKYGDJTF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|