C21H22ClNNaO8P — CID 162309058
sodium [(3R,4S)-6-acetyl-4-[(3-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate (PubChem CID 162309058) has the molecular formula C21H22ClNNaO8P and a molecular weight of 505.82 g/mol. Its IUPAC name is sodium [(3R,4S)-6-acetyl-4-[(3-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate.
| Compound Name | sodium [(3R,4S)-6-acetyl-4-[(3-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate |
|---|---|
| PubChem CID | 162309058 |
| Molecular Formula | C21H22ClNNaO8P |
| Molecular Weight | 505.82 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | sodium [(3R,4S)-6-acetyl-4-[(3-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1cccc(Cl)c1)[C@@H](OCOP(=O)([O-])O)C(C)(C)O2.[Na+] |
| InChI | InChI=1S/C21H23ClNO8P.Na/c1-12(24)13-7-8-17-16(10-13)18(23-20(25)14-5-4-6-15(22)9-14)19(21(2,3)31-17)29-11-30-32(26,27)28;/h4-10,18-19H,11H2,1-3H3,(H,23,25)(H2,26,27,28);/q;+1/p-1/t18-,19+;/m0./s1 |
| InChIKey | HWDAYOFVPVMZKO-GRTNUQQKSA-M |
| XLogP | 0.01 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.82 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|