C20H20Cl2NO7P — CID 118197890
[(3R,4S)-6-acetyl-4-[(2,3-dichlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] dihydrogen phosphate (PubChem CID 118197890) has the molecular formula C20H20Cl2NO7P and a molecular weight of 488.26 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-4-[(2,3-dichlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] dihydrogen phosphate.
| Compound Name | [(3R,4S)-6-acetyl-4-[(2,3-dichlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118197890 |
| Molecular Formula | C20H20Cl2NO7P |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [(3R,4S)-6-acetyl-4-[(2,3-dichlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl] dihydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1cccc(Cl)c1Cl)[C@@H](OP(=O)(O)O)C(C)(C)O2 |
| InChI | InChI=1S/C20H20Cl2NO7P/c1-10(24)11-7-8-15-13(9-11)17(18(20(2,3)29-15)30-31(26,27)28)23-19(25)12-5-4-6-14(21)16(12)22/h4-9,17-18H,1-3H3,(H,23,25)(H2,26,27,28)/t17-,18+/m0/s1 |
| InChIKey | GQAYTEMIMQRFGF-ZWKOTPCHSA-N |
| XLogP | 4.32 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|