C19H21ClNO8PS — CID 118197923
[(3R,4S)-6-acetyl-4-[(2-chlorothiophene-3-carbonyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate (PubChem CID 118197923) has the molecular formula C19H21ClNO8PS and a molecular weight of 489.87 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-4-[(2-chlorothiophene-3-carbonyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3R,4S)-6-acetyl-4-[(2-chlorothiophene-3-carbonyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118197923 |
| Molecular Formula | C19H21ClNO8PS |
| Molecular Weight | 489.87 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | [(3R,4S)-6-acetyl-4-[(2-chlorothiophene-3-carbonyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1ccsc1Cl)[C@@H](OCOP(=O)(O)O)C(C)(C)O2 |
| InChI | InChI=1S/C19H21ClNO8PS/c1-10(22)11-4-5-14-13(8-11)15(21-18(23)12-6-7-31-17(12)20)16(19(2,3)29-14)27-9-28-30(24,25)26/h4-8,15-16H,9H2,1-3H3,(H,21,23)(H2,24,25,26)/t15-,16+/m0/s1 |
| InChIKey | MQKUKWGQRAUAAQ-JKSUJKDBSA-N |
| XLogP | 3.70 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|