C21H25N2O8P — CID 118202756
[(3R,4S)-6-acetyl-4-[amino(benzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate (PubChem CID 118202756) has the molecular formula C21H25N2O8P and a molecular weight of 464.41 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-4-[amino(benzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3R,4S)-6-acetyl-4-[amino(benzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118202756 |
| Molecular Formula | C21H25N2O8P |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(3R,4S)-6-acetyl-4-[amino(benzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](N(N)C(=O)c1ccccc1)[C@@H](OCOP(=O)(O)O)C(C)(C)O2 |
| InChI | InChI=1S/C21H25N2O8P/c1-13(24)15-9-10-17-16(11-15)18(23(22)20(25)14-7-5-4-6-8-14)19(21(2,3)31-17)29-12-30-32(26,27)28/h4-11,18-19H,12,22H2,1-3H3,(H2,26,27,28)/t18-,19+/m0/s1 |
| InChIKey | SYDDKVKAWWEBAN-RBUKOAKNSA-N |
| XLogP | 2.57 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|