C21H22ClFNO8P — CID 118197964
[(3R,4S)-6-acetyl-4-[(3-chloro-4-fluorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate (PubChem CID 118197964) has the molecular formula C21H22ClFNO8P and a molecular weight of 501.83 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-4-[(3-chloro-4-fluorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3R,4S)-6-acetyl-4-[(3-chloro-4-fluorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118197964 |
| Molecular Formula | C21H22ClFNO8P |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | [(3R,4S)-6-acetyl-4-[(3-chloro-4-fluorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl dihydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1ccc(F)c(Cl)c1)[C@@H](OCOP(=O)(O)O)C(C)(C)O2 |
| InChI | InChI=1S/C21H22ClFNO8P/c1-11(25)12-5-7-17-14(8-12)18(24-20(26)13-4-6-16(23)15(22)9-13)19(21(2,3)32-17)30-10-31-33(27,28)29/h4-9,18-19H,10H2,1-3H3,(H,24,26)(H2,27,28,29)/t18-,19+/m0/s1 |
| InChIKey | HXMPNHDYMWUCJO-RBUKOAKNSA-N |
| XLogP | 3.78 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|