C21H22ClNO8P- — CID 140750516
[(3S,4S)-6-acetyl-4-[(2-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate (PubChem CID 140750516) has the molecular formula C21H22ClNO8P- and a molecular weight of 482.83 g/mol. Its IUPAC name is [(3S,4S)-6-acetyl-4-[(2-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate.
| Compound Name | [(3S,4S)-6-acetyl-4-[(2-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate |
|---|---|
| PubChem CID | 140750516 |
| Molecular Formula | C21H22ClNO8P- |
| Molecular Weight | 482.83 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [(3S,4S)-6-acetyl-4-[(2-chlorobenzoyl)amino]-2,2-dimethyl-3,4-dihydrochromen-3-yl]oxymethyl hydrogen phosphate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1ccccc1Cl)[C@H](OCOP(=O)([O-])O)C(C)(C)O2 |
| InChI | InChI=1S/C21H23ClNO8P/c1-12(24)13-8-9-17-15(10-13)18(23-20(25)14-6-4-5-7-16(14)22)19(21(2,3)31-17)29-11-30-32(26,27)28/h4-10,18-19H,11H2,1-3H3,(H,23,25)(H2,26,27,28)/p-1/t18-,19-/m0/s1 |
| InChIKey | NNHZEXFWGZTINH-OALUTQOASA-M |
| XLogP | 3.00 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|