About sodium;acetic acid;cyclohexane
sodium;acetic acid;cyclohexane (PubChem CID 162313099) has the molecular formula C8H15NaO2
and a molecular weight of 166.20 g/mol. Its IUPAC name is sodium;acetic acid;cyclohexane.
Molecular Properties
| Compound Name | sodium;acetic acid;cyclohexane |
| PubChem CID | 162313099 |
| Molecular Formula | C8H15NaO2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | sodium;acetic acid;cyclohexane |
| SMILES | CC(=O)O.[CH-]1CCCCC1.[Na+] |
| InChI | InChI=1S/C6H11.C2H4O2.Na/c1-2-4-6-5-3-1;1-2(3)4;/h1H,2-6H2;1H3,(H,3,4);/q-1;;+1 |
| InChIKey | SGUAJXCQQVREJR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetic acid;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;cyclohexane?
The IUPAC name of sodium;acetic acid;cyclohexane (CID 162313099) is sodium;acetic acid;cyclohexane.
What is the SMILES notation for sodium;acetic acid;cyclohexane?
The canonical SMILES for sodium;acetic acid;cyclohexane is CC(=O)O.[CH-]1CCCCC1.[Na+].
What is the InChIKey of sodium;acetic acid;cyclohexane?
The InChIKey is SGUAJXCQQVREJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11.C2H4O2.Na/c1-2-4-6-5-3-1;1-2(3)4;/h1H,2-6H2;1H3,(H,3,4);/q-1;;+1.
What are the key properties of sodium;acetic acid;cyclohexane?
sodium;acetic acid;cyclohexane has a molecular weight of 166.20 g/mol, XLogP of -0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;cyclohexane is sourced from PubChem (CID 162313099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).