C30H27IN4O2S3 — CID 162330735
N-(5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-yl)-4-methylbenzenesulfonamide iodide (PubChem CID 162330735) has the molecular formula C30H27IN4O2S3 and a molecular weight of 698.68 g/mol. Its IUPAC name is N-(5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-yl)-4-methylbenzenesulfonamide iodide.
| Compound Name | N-(5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-yl)-4-methylbenzenesulfonamide iodide |
|---|---|
| PubChem CID | 162330735 |
| Molecular Formula | C30H27IN4O2S3 |
| Molecular Weight | 698.68 g/mol |
| Exact Mass | 698.03 |
| IUPAC Name | N-(5,27-dithia-16,20-diaza-12-azoniaheptacyclo[15.11.0.03,15.04,12.06,11.020,28.021,26]octacosa-1(28),2,4(12),6,8,10,21,23,25-nonaen-16-yl)-4-methylbenzenesulfonamide iodide |
| SMILES | Cc1ccc(S(=O)(=O)NN2C3CC[n+]4c(sc5ccccc54)C3=CC3=C4Sc5ccccc5N4CCC32)cc1.[I-] |
| InChI | InChI=1S/C30H27N4O2S3.HI/c1-19-10-12-20(13-11-19)39(35,36)31-34-23-14-16-32-25-6-2-4-8-27(25)37-29(32)21(23)18-22-24(34)15-17-33-26-7-3-5-9-28(26)38-30(22)33;/h2-13,18,23-24,31H,14-17H2,1H3;1H/q+1;/p-1 |
| InChIKey | HQANKFMEHSYFEK-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 56.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|