C30H36F3N5O3 — CID 162337569
N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162337569) has the molecular formula C30H36F3N5O3 and a molecular weight of 571.64 g/mol. Its IUPAC name is N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162337569 |
| Molecular Formula | C30H36F3N5O3 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1nc(NC2CCC(CNC(=O)C3CCc4ccccc4C3)CC2)nc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H35N5O.C2HF3O2/c1-33(2)26-24-9-5-6-10-25(24)31-28(32-26)30-23-15-11-19(12-16-23)18-29-27(34)22-14-13-20-7-3-4-8-21(20)17-22;3-2(4,5)1(6)7/h3-10,19,22-23H,11-18H2,1-2H3,(H,29,34)(H,30,31,32);(H,6,7) |
| InChIKey | RMZVFOURGRYXKQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |