C21H27N3O6S2 — CID 162337786
3,4-dimethyl-2-N,6-N-diphenylpyridine-2,6-diamine;methanesulfonic acid (PubChem CID 162337786) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3,4-dimethyl-2-N,6-N-diphenylpyridine-2,6-diamine;methanesulfonic acid.
| Compound Name | 3,4-dimethyl-2-N,6-N-diphenylpyridine-2,6-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 162337786 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3,4-dimethyl-2-N,6-N-diphenylpyridine-2,6-diamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Cc1cc(Nc2ccccc2)nc(Nc2ccccc2)c1C |
| InChI | InChI=1S/C19H19N3.2CH4O3S/c1-14-13-18(20-16-9-5-3-6-10-16)22-19(15(14)2)21-17-11-7-4-8-12-17;2*1-5(2,3)4/h3-13H,1-2H3,(H2,20,21,22);2*1H3,(H,2,3,4) |
| InChIKey | VAYRRIDSXHWVGY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|