C21H21N3O2 — CID 59010294
4-[[3,4-dimethyl-6-(4-methylanilino)-2-pyridinyl]amino]benzoic acid (PubChem CID 59010294) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[[3,4-dimethyl-6-(4-methylanilino)-2-pyridinyl]amino]benzoic acid.
| Compound Name | 4-[[3,4-dimethyl-6-(4-methylanilino)-2-pyridinyl]amino]benzoic acid |
|---|---|
| PubChem CID | 59010294 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[[3,4-dimethyl-6-(4-methylanilino)-2-pyridinyl]amino]benzoic acid |
| SMILES | Cc1ccc(Nc2cc(C)c(C)c(Nc3ccc(C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-13-4-8-17(9-5-13)22-19-12-14(2)15(3)20(24-19)23-18-10-6-16(7-11-18)21(25)26/h4-12H,1-3H3,(H,25,26)(H2,22,23,24) |
| InChIKey | LFKMNAFJLFJODG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |