C12H21N3O2S — CID 162342047
3-[(9aR)-6-sulfanylidene-2,3,4,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidin-7-yl]-2,2-dimethylpropanoic acid (PubChem CID 162342047) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-[(9aR)-6-sulfanylidene-2,3,4,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidin-7-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(9aR)-6-sulfanylidene-2,3,4,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidin-7-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 162342047 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-[(9aR)-6-sulfanylidene-2,3,4,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidin-7-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1CC[C@@H]2CNCCN2C1=S)C(=O)O |
| InChI | InChI=1S/C12H21N3O2S/c1-12(2,10(16)17)8-14-5-3-9-7-13-4-6-15(9)11(14)18/h9,13H,3-8H2,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | YQBPPAZPHFSNEF-SECBINFHSA-N |
| XLogP | 0.36 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|