C11H17N3O2S — CID 162342045
1-[[(8aS)-3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid (PubChem CID 162342045) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-[[(8aS)-3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(8aS)-3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 162342045 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-[[(8aS)-3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CN2C[C@@H]3CNCCN3C2=S)CC1 |
| InChI | InChI=1S/C11H17N3O2S/c15-9(16)11(1-2-11)7-13-6-8-5-12-3-4-14(8)10(13)17/h8,12H,1-7H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | JDPTYGAUOBHLGU-QMMMGPOBSA-N |
| XLogP | -0.27 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|