C11H20ClN3O2S — CID 156904025
2-[(3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)methyl]butanoic acid;hydrochloride (PubChem CID 156904025) has the molecular formula C11H20ClN3O2S and a molecular weight of 293.82 g/mol. Its IUPAC name is 2-[(3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)methyl]butanoic acid;hydrochloride.
| Compound Name | 2-[(3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)methyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 156904025 |
| Molecular Formula | C11H20ClN3O2S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[(3-sulfanylidene-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)methyl]butanoic acid;hydrochloride |
| SMILES | CCC(CN1CC2CNCCN2C1=S)C(=O)O.Cl |
| InChI | InChI=1S/C11H19N3O2S.ClH/c1-2-8(10(15)16)6-13-7-9-5-12-3-4-14(9)11(13)17;/h8-9,12H,2-7H2,1H3,(H,15,16);1H |
| InChIKey | ARUWKXCVIVPIPU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|