C22H27F3N8O2Si — CID 162351284
2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one (PubChem CID 162351284) has the molecular formula C22H27F3N8O2Si and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one.
| Compound Name | 2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 162351284 |
| Molecular Formula | C22H27F3N8O2Si |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-(2,2,2-trifluoroethylamino)-8-[4-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-5,6-dihydropyrimido[4,5-d]pyrimidin-7-one |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2ccc(N3C(=O)NCc4cnc(NCC(F)(F)F)nc43)cc2)n1 |
| InChI | InChI=1S/C22H27F3N8O2Si/c1-36(2,3)9-8-35-14-32-13-29-18(31-32)15-4-6-17(7-5-15)33-19-16(11-27-21(33)34)10-26-20(30-19)28-12-22(23,24)25/h4-7,10,13H,8-9,11-12,14H2,1-3H3,(H,27,34)(H,26,28,30) |
| InChIKey | SRWQKDRUJRRIAS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|